C14H21NO2 — CID 135067263
ethyl (3aS,7aR)-4-cyano-1-methyl-1,2,3,3a,5,6,7,7a-octahydroindene-4-carboxylate (PubChem CID 135067263) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is ethyl (3aS,7aR)-4-cyano-1-methyl-1,2,3,3a,5,6,7,7a-octahydroindene-4-carboxylate.
| Compound Name | ethyl (3aS,7aR)-4-cyano-1-methyl-1,2,3,3a,5,6,7,7a-octahydroindene-4-carboxylate |
|---|---|
| PubChem CID | 135067263 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | ethyl (3aS,7aR)-4-cyano-1-methyl-1,2,3,3a,5,6,7,7a-octahydroindene-4-carboxylate |
| SMILES | CCOC(=O)C1(C#N)CCC[C@@H]2C(C)CC[C@@H]21 |
| InChI | InChI=1S/C14H21NO2/c1-3-17-13(16)14(9-15)8-4-5-11-10(2)6-7-12(11)14/h10-12H,3-8H2,1-2H3/t10?,11-,12+,14?/m1/s1 |
| InChIKey | XQZKQSBJLIFBEH-BEVNXUHPSA-N |
| XLogP | 2.91 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |