C23H27NO2S — CID 135067373
(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-3-prop-1-en-2-ylpyrrolidine (PubChem CID 135067373) has the molecular formula C23H27NO2S and a molecular weight of 381.54 g/mol. Its IUPAC name is (2R,3S)-3-methyl-1-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-3-prop-1-en-2-ylpyrrolidine.
| Compound Name | (2R,3S)-3-methyl-1-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-3-prop-1-en-2-ylpyrrolidine |
|---|---|
| PubChem CID | 135067373 |
| Molecular Formula | C23H27NO2S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (2R,3S)-3-methyl-1-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-3-prop-1-en-2-ylpyrrolidine |
| SMILES | C=C(C)[C@]1(C)CCN(S(=O)(=O)c2ccc(C)cc2)[C@@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C23H27NO2S/c1-18(2)23(4)16-17-24(22(23)15-12-20-8-6-5-7-9-20)27(25,26)21-13-10-19(3)11-14-21/h5-15,22H,1,16-17H2,2-4H3/b15-12+/t22-,23+/m1/s1 |
| InChIKey | IYRGOPNQSLWRNG-ARNRTBJWSA-N |
| XLogP | 5.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|