C19H27BO4 — CID 135067545
2-[4-[[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 135067545) has the molecular formula C19H27BO4 and a molecular weight of 330.23 g/mol. Its IUPAC name is 2-[4-[[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 135067545 |
| Molecular Formula | C19H27BO4 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 2-[4-[[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(C[C@H]3CO[C@H]4OCC[C@@H]34)cc2)OC1(C)C |
| InChI | InChI=1S/C19H27BO4/c1-18(2)19(3,4)24-20(23-18)15-7-5-13(6-8-15)11-14-12-22-17-16(14)9-10-21-17/h5-8,14,16-17H,9-12H2,1-4H3/t14-,16-,17+/m0/s1 |
| InChIKey | JCINEJRBJUCSOX-BHYGNILZSA-N |
| XLogP | 2.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|