C16H26OSi — CID 135067575
7-butyl-1-trimethylsilyl-1,4,5,6-tetrahydroinden-2-one (PubChem CID 135067575) has the molecular formula C16H26OSi and a molecular weight of 262.47 g/mol. Its IUPAC name is 7-butyl-1-trimethylsilyl-1,4,5,6-tetrahydroinden-2-one.
| Compound Name | 7-butyl-1-trimethylsilyl-1,4,5,6-tetrahydroinden-2-one |
|---|---|
| PubChem CID | 135067575 |
| Molecular Formula | C16H26OSi |
| Molecular Weight | 262.47 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 7-butyl-1-trimethylsilyl-1,4,5,6-tetrahydroinden-2-one |
| SMILES | CCCCC1=C2C(=CC(=O)C2[Si](C)(C)C)CCC1 |
| InChI | InChI=1S/C16H26OSi/c1-5-6-8-12-9-7-10-13-11-14(17)16(15(12)13)18(2,3)4/h11,16H,5-10H2,1-4H3 |
| InChIKey | TYDSIRHDQULCKB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|