C16H22O5 — CID 135067660
dimethyl (1R,2R,8S)-1,8-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-ene-4,4-dicarboxylate (PubChem CID 135067660) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is dimethyl (1R,2R,8S)-1,8-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-ene-4,4-dicarboxylate.
| Compound Name | dimethyl (1R,2R,8S)-1,8-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-ene-4,4-dicarboxylate |
|---|---|
| PubChem CID | 135067660 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | dimethyl (1R,2R,8S)-1,8-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-ene-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C[C@]3(C)CC[C@@](C)(O3)[C@@H]2C1 |
| InChI | InChI=1S/C16H22O5/c1-14-5-6-15(2,21-14)11-9-16(12(17)19-3,13(18)20-4)8-10(11)7-14/h7,11H,5-6,8-9H2,1-4H3/t11-,14+,15-/m1/s1 |
| InChIKey | MEPSMWPLGASIOM-BYCMXARLSA-N |
| XLogP | 2.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|