About (2S)-1-tert-butylsulfonyl-2-ethenyl-2,3-dihydroindole
(2S)-1-tert-butylsulfonyl-2-ethenyl-2,3-dihydroindole (PubChem CID 135067727) has the molecular formula C14H19NO2S
and a molecular weight of 265.38 g/mol. Its IUPAC name is (2S)-1-tert-butylsulfonyl-2-ethenyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | (2S)-1-tert-butylsulfonyl-2-ethenyl-2,3-dihydroindole |
| PubChem CID | 135067727 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (2S)-1-tert-butylsulfonyl-2-ethenyl-2,3-dihydroindole |
| SMILES | C=C[C@@H]1Cc2ccccc2N1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C14H19NO2S/c1-5-12-10-11-8-6-7-9-13(11)15(12)18(16,17)14(2,3)4/h5-9,12H,1,10H2,2-4H3/t12-/m1/s1 |
| InChIKey | VUCQKUSWPWBJPG-GFCCVEGCSA-N |
| XLogP | 2.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-tert-butylsulfonyl-2-ethenyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-tert-butylsulfonyl-2-ethenyl-2,3-dihydroindole?
The IUPAC name of (2S)-1-tert-butylsulfonyl-2-ethenyl-2,3-dihydroindole (CID 135067727) is (2S)-1-tert-butylsulfonyl-2-ethenyl-2,3-dihydroindole.
What is the SMILES notation for (2S)-1-tert-butylsulfonyl-2-ethenyl-2,3-dihydroindole?
The canonical SMILES for (2S)-1-tert-butylsulfonyl-2-ethenyl-2,3-dihydroindole is C=C[C@@H]1Cc2ccccc2N1S(=O)(=O)C(C)(C)C.
What is the InChIKey of (2S)-1-tert-butylsulfonyl-2-ethenyl-2,3-dihydroindole?
The InChIKey is VUCQKUSWPWBJPG-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H19NO2S/c1-5-12-10-11-8-6-7-9-13(11)15(12)18(16,17)14(2,3)4/h5-9,12H,1,10H2,2-4H3/t12-/m1/s1.
What are the key properties of (2S)-1-tert-butylsulfonyl-2-ethenyl-2,3-dihydroindole?
(2S)-1-tert-butylsulfonyl-2-ethenyl-2,3-dihydroindole has a molecular weight of 265.38 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-tert-butylsulfonyl-2-ethenyl-2,3-dihydroindole is sourced from PubChem (CID 135067727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).