C32H33NO6 — CID 135067793
ethyl (2R,3R,4S,5R)-4-[(4S)-2-oxo-4-propan-2-yl-1,3-oxazolidine-3-carbonyl]-2,3,5-triphenyloxolane-2-carboxylate (PubChem CID 135067793) has the molecular formula C32H33NO6 and a molecular weight of 527.62 g/mol. Its IUPAC name is ethyl (2R,3R,4S,5R)-4-[(4S)-2-oxo-4-propan-2-yl-1,3-oxazolidine-3-carbonyl]-2,3,5-triphenyloxolane-2-carboxylate.
| Compound Name | ethyl (2R,3R,4S,5R)-4-[(4S)-2-oxo-4-propan-2-yl-1,3-oxazolidine-3-carbonyl]-2,3,5-triphenyloxolane-2-carboxylate |
|---|---|
| PubChem CID | 135067793 |
| Molecular Formula | C32H33NO6 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | ethyl (2R,3R,4S,5R)-4-[(4S)-2-oxo-4-propan-2-yl-1,3-oxazolidine-3-carbonyl]-2,3,5-triphenyloxolane-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(c2ccccc2)O[C@@H](c2ccccc2)[C@@H](C(=O)N2C(=O)OC[C@@H]2C(C)C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C32H33NO6/c1-4-37-30(35)32(24-18-12-7-13-19-24)27(22-14-8-5-9-15-22)26(28(39-32)23-16-10-6-11-17-23)29(34)33-25(21(2)3)20-38-31(33)36/h5-19,21,25-28H,4,20H2,1-3H3/t25-,26+,27+,28+,32+/m1/s1 |
| InChIKey | YNNSCUPCFCSKNI-HEDZJINPSA-N |
| XLogP | 5.62 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |