About CID 135067919
CID 135067919 (PubChem CID 135067919) has the molecular formula C40H52O7SSi
and a molecular weight of 705.00 g/mol.
Molecular Properties
| Compound Name | CID 135067919 |
| PubChem CID | 135067919 |
| Molecular Formula | C40H52O7SSi |
| Molecular Weight | 705.00 g/mol |
| Exact Mass | 704.32 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S(=O)C2CC[C@@H](CO)O[C@@]23CC[C@]2(O[C@H]4C[C@H](CO[Si](c5ccccc5)(c5ccccc5)C(C)(C)C)O[C@H]4C[C@@H]2C)O3)cc1 |
| InChI | InChI=1S/C40H52O7SSi/c1-28-16-19-32(20-17-28)48(42)37-21-18-30(26-41)45-40(37)23-22-39(47-40)29(2)24-35-36(46-39)25-31(44-35)27-43-49(38(3,4)5,33-12-8-6-9-13-33)34-14-10-7-11-15-34/h6-17,19-20,29-31,35-37,41H,18,21-27H2,1-5H3/t29-,30-,31+,35-,36-,37?,39-,40+,48?/m0/s1 |
| InChIKey | OGNQYVRSJXSYKS-ZLEYYDECSA-N |
| XLogP | 6.00 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 705.00 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 135067919 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135067919?
The IUPAC name of CID 135067919 (CID 135067919) is not available.
What is the SMILES notation for CID 135067919?
The canonical SMILES for CID 135067919 is Cc1ccc(S(=O)C2CC[C@@H](CO)O[C@@]23CC[C@]2(O[C@H]4C[C@H](CO[Si](c5ccccc5)(c5ccccc5)C(C)(C)C)O[C@H]4C[C@@H]2C)O3)cc1.
What is the InChIKey of CID 135067919?
The InChIKey is OGNQYVRSJXSYKS-ZLEYYDECSA-N. The full InChI is InChI=1S/C40H52O7SSi/c1-28-16-19-32(20-17-28)48(42)37-21-18-30(26-41)45-40(37)23-22-39(47-40)29(2)24-35-36(46-39)25-31(44-35)27-43-49(38(3,4)5,33-12-8-6-9-13-33)34-14-10-7-11-15-34/h6-17,19-20,29-31,35-37,41H,18,21-27H2,1-5H3/t29-,30-,31+,35-,36-,37?,39-,40+,48?/m0/s1.
What are the key properties of CID 135067919?
CID 135067919 has a molecular weight of 705.00 g/mol, XLogP of 6.00, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135067919 is sourced from PubChem (CID 135067919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).