C24H29IN2O4 — CID 135067978
N-[2-(tert-butylamino)-1-(2-iodo-4,5-dimethoxyphenyl)-2-oxoethyl]-N-prop-2-enylbenzamide (PubChem CID 135067978) has the molecular formula C24H29IN2O4 and a molecular weight of 536.41 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-1-(2-iodo-4,5-dimethoxyphenyl)-2-oxoethyl]-N-prop-2-enylbenzamide.
| Compound Name | N-[2-(tert-butylamino)-1-(2-iodo-4,5-dimethoxyphenyl)-2-oxoethyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 135067978 |
| Molecular Formula | C24H29IN2O4 |
| Molecular Weight | 536.41 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | N-[2-(tert-butylamino)-1-(2-iodo-4,5-dimethoxyphenyl)-2-oxoethyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(C(=O)c1ccccc1)C(C(=O)NC(C)(C)C)c1cc(OC)c(OC)cc1I |
| InChI | InChI=1S/C24H29IN2O4/c1-7-13-27(23(29)16-11-9-8-10-12-16)21(22(28)26-24(2,3)4)17-14-19(30-5)20(31-6)15-18(17)25/h7-12,14-15,21H,1,13H2,2-6H3,(H,26,28) |
| InChIKey | YYUIKISKVUKQMY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|