C17H24O4 — CID 135068046
diethyl (3aR,7R)-7-methyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate (PubChem CID 135068046) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is diethyl (3aR,7R)-7-methyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate.
| Compound Name | diethyl (3aR,7R)-7-methyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 135068046 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | diethyl (3aR,7R)-7-methyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=C[C@H](C)CC=C[C@H]2C1 |
| InChI | InChI=1S/C17H24O4/c1-4-20-15(18)17(16(19)21-5-2)10-13-8-6-7-12(3)9-14(13)11-17/h6,8-9,12-13H,4-5,7,10-11H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | YKGZAMZZUAYKGQ-OLZOCXBDSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|