About [2-(5-fluoro-1,3-benzothiazol-2-yl)-3-methylphenyl] 2,2-dimethylpropanoate
[2-(5-fluoro-1,3-benzothiazol-2-yl)-3-methylphenyl] 2,2-dimethylpropanoate (PubChem CID 135068071) has the molecular formula C19H18FNO2S
and a molecular weight of 343.42 g/mol. Its IUPAC name is [2-(5-fluoro-1,3-benzothiazol-2-yl)-3-methylphenyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [2-(5-fluoro-1,3-benzothiazol-2-yl)-3-methylphenyl] 2,2-dimethylpropanoate |
| PubChem CID | 135068071 |
| Molecular Formula | C19H18FNO2S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | [2-(5-fluoro-1,3-benzothiazol-2-yl)-3-methylphenyl] 2,2-dimethylpropanoate |
| SMILES | Cc1cccc(OC(=O)C(C)(C)C)c1-c1nc2cc(F)ccc2s1 |
| InChI | InChI=1S/C19H18FNO2S/c1-11-6-5-7-14(23-18(22)19(2,3)4)16(11)17-21-13-10-12(20)8-9-15(13)24-17/h5-10H,1-4H3 |
| InChIKey | DKCXQWDMDPIIQX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(5-fluoro-1,3-benzothiazol-2-yl)-3-methylphenyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-fluoro-1,3-benzothiazol-2-yl)-3-methylphenyl] 2,2-dimethylpropanoate?
The IUPAC name of [2-(5-fluoro-1,3-benzothiazol-2-yl)-3-methylphenyl] 2,2-dimethylpropanoate (CID 135068071) is [2-(5-fluoro-1,3-benzothiazol-2-yl)-3-methylphenyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [2-(5-fluoro-1,3-benzothiazol-2-yl)-3-methylphenyl] 2,2-dimethylpropanoate?
The canonical SMILES for [2-(5-fluoro-1,3-benzothiazol-2-yl)-3-methylphenyl] 2,2-dimethylpropanoate is Cc1cccc(OC(=O)C(C)(C)C)c1-c1nc2cc(F)ccc2s1.
What is the InChIKey of [2-(5-fluoro-1,3-benzothiazol-2-yl)-3-methylphenyl] 2,2-dimethylpropanoate?
The InChIKey is DKCXQWDMDPIIQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18FNO2S/c1-11-6-5-7-14(23-18(22)19(2,3)4)16(11)17-21-13-10-12(20)8-9-15(13)24-17/h5-10H,1-4H3.
What are the key properties of [2-(5-fluoro-1,3-benzothiazol-2-yl)-3-methylphenyl] 2,2-dimethylpropanoate?
[2-(5-fluoro-1,3-benzothiazol-2-yl)-3-methylphenyl] 2,2-dimethylpropanoate has a molecular weight of 343.42 g/mol, XLogP of 5.36, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-fluoro-1,3-benzothiazol-2-yl)-3-methylphenyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 135068071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).