C24H48O2Si2 — CID 135068100
(4E,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-7-heptyl-6-trimethylsilylcyclooct-4-en-1-one (PubChem CID 135068100) has the molecular formula C24H48O2Si2 and a molecular weight of 424.82 g/mol. Its IUPAC name is (4E,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-7-heptyl-6-trimethylsilylcyclooct-4-en-1-one.
| Compound Name | (4E,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-7-heptyl-6-trimethylsilylcyclooct-4-en-1-one |
|---|---|
| PubChem CID | 135068100 |
| Molecular Formula | C24H48O2Si2 |
| Molecular Weight | 424.82 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | (4E,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-7-heptyl-6-trimethylsilylcyclooct-4-en-1-one |
| SMILES | CCCCCCC[C@@H]1CC(=O)CC/C(O[Si](C)(C)C(C)(C)C)=C\[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C24H48O2Si2/c1-10-11-12-13-14-15-20-18-21(25)16-17-22(19-23(20)27(5,6)7)26-28(8,9)24(2,3)4/h19-20,23H,10-18H2,1-9H3/b22-19+/t20-,23+/m1/s1 |
| InChIKey | CNDXZYKTINQSIB-LNOXEYCCSA-N |
| XLogP | 8.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.82 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|