C14H30O4Si — CID 135068104
tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutanoate (PubChem CID 135068104) has the molecular formula C14H30O4Si and a molecular weight of 290.48 g/mol. Its IUPAC name is tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutanoate.
| Compound Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutanoate |
|---|---|
| PubChem CID | 135068104 |
| Molecular Formula | C14H30O4Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutanoate |
| SMILES | CC(O)C(O[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H30O4Si/c1-10(15)11(12(16)17-13(2,3)4)18-19(8,9)14(5,6)7/h10-11,15H,1-9H3 |
| InChIKey | CVYHVUHXAUABGT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|