C8H10O4 — CID 135068225
methyl (3R,5R)-5-ethenyl-2-oxooxolane-3-carboxylate (PubChem CID 135068225) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is methyl (3R,5R)-5-ethenyl-2-oxooxolane-3-carboxylate.
| Compound Name | methyl (3R,5R)-5-ethenyl-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 135068225 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | methyl (3R,5R)-5-ethenyl-2-oxooxolane-3-carboxylate |
| SMILES | C=C[C@H]1C[C@H](C(=O)OC)C(=O)O1 |
| InChI | InChI=1S/C8H10O4/c1-3-5-4-6(7(9)11-2)8(10)12-5/h3,5-6H,1,4H2,2H3/t5-,6+/m0/s1 |
| InChIKey | HDUTUOKGDKQIKK-NTSWFWBYSA-N |
| XLogP | 0.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|