C21H23NO4 — CID 135068259
2-O-ethyl 4-O-methyl (2R,4S,5R)-1,5-diphenylpyrrolidine-2,4-dicarboxylate (PubChem CID 135068259) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-O-ethyl 4-O-methyl (2R,4S,5R)-1,5-diphenylpyrrolidine-2,4-dicarboxylate.
| Compound Name | 2-O-ethyl 4-O-methyl (2R,4S,5R)-1,5-diphenylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 135068259 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-O-ethyl 4-O-methyl (2R,4S,5R)-1,5-diphenylpyrrolidine-2,4-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@H](C(=O)OC)[C@H](c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C21H23NO4/c1-3-26-21(24)18-14-17(20(23)25-2)19(15-10-6-4-7-11-15)22(18)16-12-8-5-9-13-16/h4-13,17-19H,3,14H2,1-2H3/t17-,18+,19-/m0/s1 |
| InChIKey | WSKYYZCLTRWDAH-OTWHNJEPSA-N |
| XLogP | 3.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |