C15H21NO5 — CID 135068277
diethyl (2S,3R)-2-(benzylamino)-3-hydroxybutanedioate (PubChem CID 135068277) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is diethyl (2S,3R)-2-(benzylamino)-3-hydroxybutanedioate.
| Compound Name | diethyl (2S,3R)-2-(benzylamino)-3-hydroxybutanedioate |
|---|---|
| PubChem CID | 135068277 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | diethyl (2S,3R)-2-(benzylamino)-3-hydroxybutanedioate |
| SMILES | CCOC(=O)[C@@H](NCc1ccccc1)[C@@H](O)C(=O)OCC |
| InChI | InChI=1S/C15H21NO5/c1-3-20-14(18)12(13(17)15(19)21-4-2)16-10-11-8-6-5-7-9-11/h5-9,12-13,16-17H,3-4,10H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | OJQWQXRMQBGPPZ-QWHCGFSZSA-N |
| XLogP | 0.63 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |