About [7-methoxy-3-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)naphthalen-2-yl] acetate
[7-methoxy-3-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)naphthalen-2-yl] acetate (PubChem CID 135068356) has the molecular formula C22H19NO4
and a molecular weight of 361.40 g/mol. Its IUPAC name is [7-methoxy-3-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)naphthalen-2-yl] acetate.
Molecular Properties
| Compound Name | [7-methoxy-3-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)naphthalen-2-yl] acetate |
| PubChem CID | 135068356 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | [7-methoxy-3-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)naphthalen-2-yl] acetate |
| SMILES | COc1ccc2cc(-c3ccc4c(n3)CCCC4=O)c(OC(C)=O)cc2c1 |
| InChI | InChI=1S/C22H19NO4/c1-13(24)27-22-12-15-10-16(26-2)7-6-14(15)11-18(22)20-9-8-17-19(23-20)4-3-5-21(17)25/h6-12H,3-5H2,1-2H3 |
| InChIKey | QQHRFUWYEBMTFF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [7-methoxy-3-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)naphthalen-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-methoxy-3-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)naphthalen-2-yl] acetate?
The IUPAC name of [7-methoxy-3-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)naphthalen-2-yl] acetate (CID 135068356) is [7-methoxy-3-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)naphthalen-2-yl] acetate.
What is the SMILES notation for [7-methoxy-3-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)naphthalen-2-yl] acetate?
The canonical SMILES for [7-methoxy-3-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)naphthalen-2-yl] acetate is COc1ccc2cc(-c3ccc4c(n3)CCCC4=O)c(OC(C)=O)cc2c1.
What is the InChIKey of [7-methoxy-3-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)naphthalen-2-yl] acetate?
The InChIKey is QQHRFUWYEBMTFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19NO4/c1-13(24)27-22-12-15-10-16(26-2)7-6-14(15)11-18(22)20-9-8-17-19(23-20)4-3-5-21(17)25/h6-12H,3-5H2,1-2H3.
What are the key properties of [7-methoxy-3-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)naphthalen-2-yl] acetate?
[7-methoxy-3-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)naphthalen-2-yl] acetate has a molecular weight of 361.40 g/mol, XLogP of 4.35, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [7-methoxy-3-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)naphthalen-2-yl] acetate is sourced from PubChem (CID 135068356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).