C21H38O2Si — CID 135068392
[(1S,2R,5S,8S)-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-6-en-5-yl]oxy-triethylsilane (PubChem CID 135068392) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is [(1S,2R,5S,8S)-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-6-en-5-yl]oxy-triethylsilane.
| Compound Name | [(1S,2R,5S,8S)-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-6-en-5-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 135068392 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | [(1S,2R,5S,8S)-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-6-en-5-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@]1(C)CC[C@@H]2C1=C[C@@]1(C(C)C)CC[C@]2(C)O1 |
| InChI | InChI=1S/C21H38O2Si/c1-8-24(9-2,10-3)23-20(7)12-11-17-18(20)15-21(16(4)5)14-13-19(17,6)22-21/h15-17H,8-14H2,1-7H3/t17-,19+,20+,21-/m1/s1 |
| InChIKey | ZHCLHQMNILVSTQ-BVOGOJNSSA-N |
| XLogP | 6.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|