C15H20O6 — CID 135068514
diethyl (1R,5R,6S)-5-methyl-7-methylidene-2-oxo-8-oxabicyclo[3.2.1]octane-1,6-dicarboxylate (PubChem CID 135068514) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is diethyl (1R,5R,6S)-5-methyl-7-methylidene-2-oxo-8-oxabicyclo[3.2.1]octane-1,6-dicarboxylate.
| Compound Name | diethyl (1R,5R,6S)-5-methyl-7-methylidene-2-oxo-8-oxabicyclo[3.2.1]octane-1,6-dicarboxylate |
|---|---|
| PubChem CID | 135068514 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | diethyl (1R,5R,6S)-5-methyl-7-methylidene-2-oxo-8-oxabicyclo[3.2.1]octane-1,6-dicarboxylate |
| SMILES | C=C1[C@H](C(=O)OCC)[C@@]2(C)CCC(=O)[C@]1(C(=O)OCC)O2 |
| InChI | InChI=1S/C15H20O6/c1-5-19-12(17)11-9(3)15(13(18)20-6-2)10(16)7-8-14(11,4)21-15/h11H,3,5-8H2,1-2,4H3/t11-,14-,15-/m1/s1 |
| InChIKey | NAQMZKBSQLWOHV-KCPJHIHWSA-N |
| XLogP | 1.18 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|