C15H19NO2 — CID 135068523
(1S,2S,6S,7R)-N,N-diethyl-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxamide (PubChem CID 135068523) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (1S,2S,6S,7R)-N,N-diethyl-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxamide.
| Compound Name | (1S,2S,6S,7R)-N,N-diethyl-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxamide |
|---|---|
| PubChem CID | 135068523 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (1S,2S,6S,7R)-N,N-diethyl-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C[C@H]2[C@@H](C1=O)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C15H19NO2/c1-3-16(4-2)15(18)12-8-11-9-5-6-10(7-9)13(11)14(12)17/h5-6,8-11,13H,3-4,7H2,1-2H3/t9-,10+,11-,13+/m1/s1 |
| InChIKey | JXUPGWLMAWNILK-XZUYRWCXSA-N |
| XLogP | 1.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|