C19H36O2Si2 — CID 135068591
(1S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-trimethylsilylbicyclo[3.3.2]dec-2-en-9-one (PubChem CID 135068591) has the molecular formula C19H36O2Si2 and a molecular weight of 352.67 g/mol. Its IUPAC name is (1S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-trimethylsilylbicyclo[3.3.2]dec-2-en-9-one.
| Compound Name | (1S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-trimethylsilylbicyclo[3.3.2]dec-2-en-9-one |
|---|---|
| PubChem CID | 135068591 |
| Molecular Formula | C19H36O2Si2 |
| Molecular Weight | 352.67 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | (1S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-trimethylsilylbicyclo[3.3.2]dec-2-en-9-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C[C@H]([Si](C)(C)C)[C@H]2CCC[C@@H]1C(=O)C2 |
| InChI | InChI=1S/C19H36O2Si2/c1-19(2,3)23(7,8)21-17-13-18(22(4,5)6)14-10-9-11-15(17)16(20)12-14/h13-15,18H,9-12H2,1-8H3/t14-,15+,18-/m0/s1 |
| InChIKey | VPDCFTLGSOARDH-DAYGRLMNSA-N |
| XLogP | 5.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|