C17H29BrO3 — CID 135068603
(1S,3S,8R,11R)-14-bromo-1,8,13,13-tetramethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecane (PubChem CID 135068603) has the molecular formula C17H29BrO3 and a molecular weight of 361.32 g/mol. Its IUPAC name is (1S,3S,8R,11R)-14-bromo-1,8,13,13-tetramethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecane.
| Compound Name | (1S,3S,8R,11R)-14-bromo-1,8,13,13-tetramethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecane |
|---|---|
| PubChem CID | 135068603 |
| Molecular Formula | C17H29BrO3 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (1S,3S,8R,11R)-14-bromo-1,8,13,13-tetramethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecane |
| SMILES | CC1(C)O[C@@H]2CC[C@@]3(C)OCCC[C@@H]3O[C@@]2(C)CCC1Br |
| InChI | InChI=1S/C17H29BrO3/c1-15(2)12(18)7-9-17(4)14(20-15)8-10-16(3)13(21-17)6-5-11-19-16/h12-14H,5-11H2,1-4H3/t12?,13-,14+,16+,17-/m0/s1 |
| InChIKey | UMVBEUYYLVPEJO-LPCNQVGISA-N |
| XLogP | 4.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|