C19H40OSi2 — CID 135068616
triethyl-[(3E)-4-triethylsilylhepta-3,6-dien-2-yl]oxysilane (PubChem CID 135068616) has the molecular formula C19H40OSi2 and a molecular weight of 340.70 g/mol. Its IUPAC name is triethyl-[(3E)-4-triethylsilylhepta-3,6-dien-2-yl]oxysilane.
| Compound Name | triethyl-[(3E)-4-triethylsilylhepta-3,6-dien-2-yl]oxysilane |
|---|---|
| PubChem CID | 135068616 |
| Molecular Formula | C19H40OSi2 |
| Molecular Weight | 340.70 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | triethyl-[(3E)-4-triethylsilylhepta-3,6-dien-2-yl]oxysilane |
| SMILES | C=CC/C(=C\C(C)O[Si](CC)(CC)CC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H40OSi2/c1-9-16-19(21(10-2,11-3)12-4)17-18(8)20-22(13-5,14-6)15-7/h9,17-18H,1,10-16H2,2-8H3/b19-17+ |
| InChIKey | RXEHCDUZAWLHGL-HTXNQAPBSA-N |
| XLogP | 6.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.70 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|