About dimethyl 3-acetyloxy-11-butyl-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate
dimethyl 3-acetyloxy-11-butyl-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate (PubChem CID 135068846) has the molecular formula C20H26O8
and a molecular weight of 394.42 g/mol. Its IUPAC name is dimethyl 3-acetyloxy-11-butyl-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 3-acetyloxy-11-butyl-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate |
| PubChem CID | 135068846 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | dimethyl 3-acetyloxy-11-butyl-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate |
| SMILES | CCCCC1C2C(=O)C3(OC(C)=O)OCCC1C3C(C(=O)OC)=C2C(=O)OC |
| InChI | InChI=1S/C20H26O8/c1-5-6-7-11-12-8-9-27-20(28-10(2)21)16(12)15(19(24)26-4)14(18(23)25-3)13(11)17(20)22/h11-13,16H,5-9H2,1-4H3 |
| InChIKey | QUXGWZAYWQAGFN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 3-acetyloxy-11-butyl-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3-acetyloxy-11-butyl-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate?
The IUPAC name of dimethyl 3-acetyloxy-11-butyl-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate (CID 135068846) is dimethyl 3-acetyloxy-11-butyl-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate.
What is the SMILES notation for dimethyl 3-acetyloxy-11-butyl-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate?
The canonical SMILES for dimethyl 3-acetyloxy-11-butyl-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate is CCCCC1C2C(=O)C3(OC(C)=O)OCCC1C3C(C(=O)OC)=C2C(=O)OC.
What is the InChIKey of dimethyl 3-acetyloxy-11-butyl-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate?
The InChIKey is QUXGWZAYWQAGFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O8/c1-5-6-7-11-12-8-9-27-20(28-10(2)21)16(12)15(19(24)26-4)14(18(23)25-3)13(11)17(20)22/h11-13,16H,5-9H2,1-4H3.
What are the key properties of dimethyl 3-acetyloxy-11-butyl-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate?
dimethyl 3-acetyloxy-11-butyl-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate has a molecular weight of 394.42 g/mol, XLogP of 1.56, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3-acetyloxy-11-butyl-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate is sourced from PubChem (CID 135068846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).