C17H24O6 — CID 135068954
1-O-tert-butyl 6-O-ethyl (1R,5R,6S)-5-methyl-7-methylidene-2-oxo-8-oxabicyclo[3.2.1]octane-1,6-dicarboxylate (PubChem CID 135068954) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is 1-O-tert-butyl 6-O-ethyl (1R,5R,6S)-5-methyl-7-methylidene-2-oxo-8-oxabicyclo[3.2.1]octane-1,6-dicarboxylate.
| Compound Name | 1-O-tert-butyl 6-O-ethyl (1R,5R,6S)-5-methyl-7-methylidene-2-oxo-8-oxabicyclo[3.2.1]octane-1,6-dicarboxylate |
|---|---|
| PubChem CID | 135068954 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-O-tert-butyl 6-O-ethyl (1R,5R,6S)-5-methyl-7-methylidene-2-oxo-8-oxabicyclo[3.2.1]octane-1,6-dicarboxylate |
| SMILES | C=C1[C@H](C(=O)OCC)[C@@]2(C)CCC(=O)[C@]1(C(=O)OC(C)(C)C)O2 |
| InChI | InChI=1S/C17H24O6/c1-7-21-13(19)12-10(2)17(14(20)22-15(3,4)5)11(18)8-9-16(12,6)23-17/h12H,2,7-9H2,1,3-6H3/t12-,16-,17-/m1/s1 |
| InChIKey | NTRHLNUCPCTDGQ-CSMYWGQOSA-N |
| XLogP | 1.95 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|