About (R)-N-[(1S,2R)-2-tert-butyl-2-hydroxycyclohexyl]-2-methylpropane-2-sulfinamide
(R)-N-[(1S,2R)-2-tert-butyl-2-hydroxycyclohexyl]-2-methylpropane-2-sulfinamide (PubChem CID 135068976) has the molecular formula C14H29NO2S
and a molecular weight of 275.46 g/mol. Its IUPAC name is (R)-N-[(1S,2R)-2-tert-butyl-2-hydroxycyclohexyl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (R)-N-[(1S,2R)-2-tert-butyl-2-hydroxycyclohexyl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 135068976 |
| Molecular Formula | C14H29NO2S |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (R)-N-[(1S,2R)-2-tert-butyl-2-hydroxycyclohexyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@H]1CCCC[C@@]1(O)C(C)(C)C |
| InChI | InChI=1S/C14H29NO2S/c1-12(2,3)14(16)10-8-7-9-11(14)15-18(17)13(4,5)6/h11,15-16H,7-10H2,1-6H3/t11-,14-,18+/m0/s1 |
| InChIKey | WXQAHQGAFCMMIU-KQYVJACZSA-N |
| XLogP | 2.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (R)-N-[(1S,2R)-2-tert-butyl-2-hydroxycyclohexyl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-N-[(1S,2R)-2-tert-butyl-2-hydroxycyclohexyl]-2-methylpropane-2-sulfinamide?
The IUPAC name of (R)-N-[(1S,2R)-2-tert-butyl-2-hydroxycyclohexyl]-2-methylpropane-2-sulfinamide (CID 135068976) is (R)-N-[(1S,2R)-2-tert-butyl-2-hydroxycyclohexyl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (R)-N-[(1S,2R)-2-tert-butyl-2-hydroxycyclohexyl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for (R)-N-[(1S,2R)-2-tert-butyl-2-hydroxycyclohexyl]-2-methylpropane-2-sulfinamide is CC(C)(C)[S@@](=O)N[C@H]1CCCC[C@@]1(O)C(C)(C)C.
What is the InChIKey of (R)-N-[(1S,2R)-2-tert-butyl-2-hydroxycyclohexyl]-2-methylpropane-2-sulfinamide?
The InChIKey is WXQAHQGAFCMMIU-KQYVJACZSA-N. The full InChI is InChI=1S/C14H29NO2S/c1-12(2,3)14(16)10-8-7-9-11(14)15-18(17)13(4,5)6/h11,15-16H,7-10H2,1-6H3/t11-,14-,18+/m0/s1.
What are the key properties of (R)-N-[(1S,2R)-2-tert-butyl-2-hydroxycyclohexyl]-2-methylpropane-2-sulfinamide?
(R)-N-[(1S,2R)-2-tert-butyl-2-hydroxycyclohexyl]-2-methylpropane-2-sulfinamide has a molecular weight of 275.46 g/mol, XLogP of 2.76, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-N-[(1S,2R)-2-tert-butyl-2-hydroxycyclohexyl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 135068976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).