C33H64O7Si2 — CID 135069074
ethyl (5S,7S,9E,13S,14R,16E)-5,13-bis[[tert-butyl(dimethyl)silyl]oxy]-7,18-dihydroxy-14-methyl-3-oxooctadeca-9,16-dienoate (PubChem CID 135069074) has the molecular formula C33H64O7Si2 and a molecular weight of 629.04 g/mol. Its IUPAC name is ethyl (5S,7S,9E,13S,14R,16E)-5,13-bis[[tert-butyl(dimethyl)silyl]oxy]-7,18-dihydroxy-14-methyl-3-oxooctadeca-9,16-dienoate.
| Compound Name | ethyl (5S,7S,9E,13S,14R,16E)-5,13-bis[[tert-butyl(dimethyl)silyl]oxy]-7,18-dihydroxy-14-methyl-3-oxooctadeca-9,16-dienoate |
|---|---|
| PubChem CID | 135069074 |
| Molecular Formula | C33H64O7Si2 |
| Molecular Weight | 629.04 g/mol |
| Exact Mass | 628.42 |
| IUPAC Name | ethyl (5S,7S,9E,13S,14R,16E)-5,13-bis[[tert-butyl(dimethyl)silyl]oxy]-7,18-dihydroxy-14-methyl-3-oxooctadeca-9,16-dienoate |
| SMILES | CCOC(=O)CC(=O)C[C@H](C[C@@H](O)C/C=C/CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C/C=C/CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H64O7Si2/c1-13-38-31(37)25-28(36)24-29(39-41(9,10)32(3,4)5)23-27(35)20-15-14-16-21-30(26(2)19-17-18-22-34)40-42(11,12)33(6,7)8/h14-15,17-18,26-27,29-30,34-35H,13,16,19-25H2,1-12H3/b15-14+,18-17+/t26-,27+,29+,30+/m1/s1 |
| InChIKey | SHQQYYJFUNZRPP-ZZDNPDFNSA-N |
| XLogP | 7.73 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.04 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|