C20H18F9NO5S — CID 135069104
[2-tert-butyl-6-[(E)-2-(furan-2-yl)ethenyl]-3-methoxy-4-pyridinyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 135069104) has the molecular formula C20H18F9NO5S and a molecular weight of 555.42 g/mol. Its IUPAC name is [2-tert-butyl-6-[(E)-2-(furan-2-yl)ethenyl]-3-methoxy-4-pyridinyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [2-tert-butyl-6-[(E)-2-(furan-2-yl)ethenyl]-3-methoxy-4-pyridinyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 135069104 |
| Molecular Formula | C20H18F9NO5S |
| Molecular Weight | 555.42 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | [2-tert-butyl-6-[(E)-2-(furan-2-yl)ethenyl]-3-methoxy-4-pyridinyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | COc1c(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc(/C=C/c2ccco2)nc1C(C)(C)C |
| InChI | InChI=1S/C20H18F9NO5S/c1-16(2,3)15-14(33-4)13(10-11(30-15)7-8-12-6-5-9-34-12)35-36(31,32)20(28,29)18(23,24)17(21,22)19(25,26)27/h5-10H,1-4H3/b8-7+ |
| InChIKey | ZLGOBGRPGWGDRQ-BQYQJAHWSA-N |
| XLogP | 6.29 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.42 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|