C38H45NP2 — CID 135069231
2,2-bis[bis(2,4,6-trimethylphenyl)phosphanyl]acetonitrile (PubChem CID 135069231) has the molecular formula C38H45NP2 and a molecular weight of 577.73 g/mol. Its IUPAC name is 2,2-bis[bis(2,4,6-trimethylphenyl)phosphanyl]acetonitrile.
| Compound Name | 2,2-bis[bis(2,4,6-trimethylphenyl)phosphanyl]acetonitrile |
|---|---|
| PubChem CID | 135069231 |
| Molecular Formula | C38H45NP2 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | 2,2-bis[bis(2,4,6-trimethylphenyl)phosphanyl]acetonitrile |
| SMILES | Cc1cc(C)c(P(c2c(C)cc(C)cc2C)C(C#N)P(c2c(C)cc(C)cc2C)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C38H45NP2/c1-22-13-26(5)35(27(6)14-22)40(36-28(7)15-23(2)16-29(36)8)34(21-39)41(37-30(9)17-24(3)18-31(37)10)38-32(11)19-25(4)20-33(38)12/h13-20,34H,1-12H3 |
| InChIKey | XUONEHZLQOMLGP-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|