About cis-(1R,2R)-2-(hydroxymethyl)-2-methylcyclopentan-1-ol
cis-(1R,2R)-2-(hydroxymethyl)-2-methylcyclopentan-1-ol (PubChem CID 135069309) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is cis-(1R,2R)-2-(hydroxymethyl)-2-methylcyclopentan-1-ol.
Molecular Properties
| Compound Name | cis-(1R,2R)-2-(hydroxymethyl)-2-methylcyclopentan-1-ol |
| PubChem CID | 135069309 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | cis-(1R,2R)-2-(hydroxymethyl)-2-methylcyclopentan-1-ol |
| SMILES | C[C@]1(CO)CCC[C@H]1O |
| InChI | InChI=1S/C7H14O2/c1-7(5-8)4-2-3-6(7)9/h6,8-9H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | ASOYCZNOWRMUNI-RNFRBKRXSA-N |
| XLogP | 0.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1R,2R)-2-(hydroxymethyl)-2-methylcyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2R)-2-(hydroxymethyl)-2-methylcyclopentan-1-ol?
The IUPAC name of cis-(1R,2R)-2-(hydroxymethyl)-2-methylcyclopentan-1-ol (CID 135069309) is cis-(1R,2R)-2-(hydroxymethyl)-2-methylcyclopentan-1-ol.
What is the SMILES notation for cis-(1R,2R)-2-(hydroxymethyl)-2-methylcyclopentan-1-ol?
The canonical SMILES for cis-(1R,2R)-2-(hydroxymethyl)-2-methylcyclopentan-1-ol is C[C@]1(CO)CCC[C@H]1O.
What is the InChIKey of cis-(1R,2R)-2-(hydroxymethyl)-2-methylcyclopentan-1-ol?
The InChIKey is ASOYCZNOWRMUNI-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H14O2/c1-7(5-8)4-2-3-6(7)9/h6,8-9H,2-5H2,1H3/t6-,7-/m1/s1.
What are the key properties of cis-(1R,2R)-2-(hydroxymethyl)-2-methylcyclopentan-1-ol?
cis-(1R,2R)-2-(hydroxymethyl)-2-methylcyclopentan-1-ol has a molecular weight of 130.19 g/mol, XLogP of 0.53, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2R)-2-(hydroxymethyl)-2-methylcyclopentan-1-ol is sourced from PubChem (CID 135069309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).