C40H38P2S — CID 135069708
[(12R)-13-tert-butyl-13-sulfanylidene-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-12-yl]-bis(2-methylphenyl)phosphane (PubChem CID 135069708) has the molecular formula C40H38P2S and a molecular weight of 612.76 g/mol. Its IUPAC name is [(12R)-13-tert-butyl-13-sulfanylidene-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-12-yl]-bis(2-methylphenyl)phosphane.
| Compound Name | [(12R)-13-tert-butyl-13-sulfanylidene-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-12-yl]-bis(2-methylphenyl)phosphane |
|---|---|
| PubChem CID | 135069708 |
| Molecular Formula | C40H38P2S |
| Molecular Weight | 612.76 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | [(12R)-13-tert-butyl-13-sulfanylidene-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-12-yl]-bis(2-methylphenyl)phosphane |
| SMILES | Cc1ccccc1P(c1ccccc1C)[C@H]1c2ccc3ccccc3c2-c2c(ccc3ccccc23)CP1(=S)C(C)(C)C |
| InChI | InChI=1S/C40H38P2S/c1-27-14-6-12-20-35(27)41(36-21-13-7-15-28(36)2)39-34-25-24-30-17-9-11-19-33(30)38(34)37-31(26-42(39,43)40(3,4)5)23-22-29-16-8-10-18-32(29)37/h6-25,39H,26H2,1-5H3/t39-,42?/m1/s1 |
| InChIKey | QDJJEJLPYRIEFH-SJGWSWOZSA-N |
| XLogP | 11.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.76 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|