C24H25F2NO — CID 135070050
(2S,3S)-3-(dibenzylamino)-1,1-difluoro-4-phenylbutan-2-ol (PubChem CID 135070050) has the molecular formula C24H25F2NO and a molecular weight of 381.47 g/mol. Its IUPAC name is (2S,3S)-3-(dibenzylamino)-1,1-difluoro-4-phenylbutan-2-ol.
| Compound Name | (2S,3S)-3-(dibenzylamino)-1,1-difluoro-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 135070050 |
| Molecular Formula | C24H25F2NO |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (2S,3S)-3-(dibenzylamino)-1,1-difluoro-4-phenylbutan-2-ol |
| SMILES | O[C@H](C(F)F)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H25F2NO/c25-24(26)23(28)22(16-19-10-4-1-5-11-19)27(17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21/h1-15,22-24,28H,16-18H2/t22-,23-/m0/s1 |
| InChIKey | DRNZINJJERGIKZ-GOTSBHOMSA-N |
| XLogP | 4.93 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |