About methyl (2S)-2-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-3-yl]but-3-enoate
methyl (2S)-2-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-3-yl]but-3-enoate (PubChem CID 135070058) has the molecular formula C19H25NO4S
and a molecular weight of 363.48 g/mol. Its IUPAC name is methyl (2S)-2-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-3-yl]but-3-enoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-3-yl]but-3-enoate |
| PubChem CID | 135070058 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | methyl (2S)-2-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-3-yl]but-3-enoate |
| SMILES | C=CC[C@H]1CN(S(=O)(=O)c2ccc(C)cc2)C[C@@H]1[C@H](C=C)C(=O)OC |
| InChI | InChI=1S/C19H25NO4S/c1-5-7-15-12-20(13-18(15)17(6-2)19(21)24-4)25(22,23)16-10-8-14(3)9-11-16/h5-6,8-11,15,17-18H,1-2,7,12-13H2,3-4H3/t15-,17-,18-/m0/s1 |
| InChIKey | CKPAIUZTOOALQU-SZMVWBNQSA-N |
| XLogP | 2.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-3-yl]but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-3-yl]but-3-enoate?
The IUPAC name of methyl (2S)-2-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-3-yl]but-3-enoate (CID 135070058) is methyl (2S)-2-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-3-yl]but-3-enoate.
What is the SMILES notation for methyl (2S)-2-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-3-yl]but-3-enoate?
The canonical SMILES for methyl (2S)-2-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-3-yl]but-3-enoate is C=CC[C@H]1CN(S(=O)(=O)c2ccc(C)cc2)C[C@@H]1[C@H](C=C)C(=O)OC.
What is the InChIKey of methyl (2S)-2-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-3-yl]but-3-enoate?
The InChIKey is CKPAIUZTOOALQU-SZMVWBNQSA-N. The full InChI is InChI=1S/C19H25NO4S/c1-5-7-15-12-20(13-18(15)17(6-2)19(21)24-4)25(22,23)16-10-8-14(3)9-11-16/h5-6,8-11,15,17-18H,1-2,7,12-13H2,3-4H3/t15-,17-,18-/m0/s1.
What are the key properties of methyl (2S)-2-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-3-yl]but-3-enoate?
methyl (2S)-2-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-3-yl]but-3-enoate has a molecular weight of 363.48 g/mol, XLogP of 2.78, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-3-yl]but-3-enoate is sourced from PubChem (CID 135070058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).