C18H36OSi — CID 135070086
tert-butyl-[(2R,3E,5E)-5-ethyl-2,4-dimethylocta-3,5-dienoxy]-dimethylsilane (PubChem CID 135070086) has the molecular formula C18H36OSi and a molecular weight of 296.57 g/mol. Its IUPAC name is tert-butyl-[(2R,3E,5E)-5-ethyl-2,4-dimethylocta-3,5-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3E,5E)-5-ethyl-2,4-dimethylocta-3,5-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135070086 |
| Molecular Formula | C18H36OSi |
| Molecular Weight | 296.57 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | tert-butyl-[(2R,3E,5E)-5-ethyl-2,4-dimethylocta-3,5-dienoxy]-dimethylsilane |
| SMILES | CC/C=C(CC)/C(C)=C/[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36OSi/c1-10-12-17(11-2)16(4)13-15(3)14-19-20(8,9)18(5,6)7/h12-13,15H,10-11,14H2,1-9H3/b16-13+,17-12+/t15-/m1/s1 |
| InChIKey | YPDSFJJETJHYRV-IEPYAJHESA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|