C11H13NO — CID 135070333
2-ethenyl-6-methylidene-1,2,5,8a-tetrahydroindolizin-3-one (PubChem CID 135070333) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-ethenyl-6-methylidene-1,2,5,8a-tetrahydroindolizin-3-one.
| Compound Name | 2-ethenyl-6-methylidene-1,2,5,8a-tetrahydroindolizin-3-one |
|---|---|
| PubChem CID | 135070333 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-ethenyl-6-methylidene-1,2,5,8a-tetrahydroindolizin-3-one |
| SMILES | C=CC1CC2C=CC(=C)CN2C1=O |
| InChI | InChI=1S/C11H13NO/c1-3-9-6-10-5-4-8(2)7-12(10)11(9)13/h3-5,9-10H,1-2,6-7H2 |
| InChIKey | UMVPATGOLXPRGG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|