C8H17O9P — CID 135070483
[(2S)-2,3,4-trihydroxy-6-(methoxymethyl)oxan-2-yl]methyl dihydrogen phosphate (PubChem CID 135070483) has the molecular formula C8H17O9P and a molecular weight of 288.19 g/mol. Its IUPAC name is [(2S)-2,3,4-trihydroxy-6-(methoxymethyl)oxan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S)-2,3,4-trihydroxy-6-(methoxymethyl)oxan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 135070483 |
| Molecular Formula | C8H17O9P |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | [(2S)-2,3,4-trihydroxy-6-(methoxymethyl)oxan-2-yl]methyl dihydrogen phosphate |
| SMILES | COCC1CC(O)C(O)[C@](O)(COP(=O)(O)O)O1 |
| InChI | InChI=1S/C8H17O9P/c1-15-3-5-2-6(9)7(10)8(11,17-5)4-16-18(12,13)14/h5-7,9-11H,2-4H2,1H3,(H2,12,13,14)/t5?,6?,7?,8-/m0/s1 |
| InChIKey | ZIENWYCEKSPRAI-AWEWAEBESA-N |
| XLogP | -2.06 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|