C12H15NO — CID 135070599
2-ethenyl-6-prop-1-en-2-yl-1,2,5,8-tetrahydropyrrolizin-3-one (PubChem CID 135070599) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-ethenyl-6-prop-1-en-2-yl-1,2,5,8-tetrahydropyrrolizin-3-one.
| Compound Name | 2-ethenyl-6-prop-1-en-2-yl-1,2,5,8-tetrahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 135070599 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-ethenyl-6-prop-1-en-2-yl-1,2,5,8-tetrahydropyrrolizin-3-one |
| SMILES | C=CC1CC2C=C(C(=C)C)CN2C1=O |
| InChI | InChI=1S/C12H15NO/c1-4-9-5-11-6-10(8(2)3)7-13(11)12(9)14/h4,6,9,11H,1-2,5,7H2,3H3 |
| InChIKey | VNCUQSLIAUAFJI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|