C17H34N2O2 — CID 135070776
4-(2,3,3,4-tetramethyl-5-morpholin-4-ylpentyl)morpholine (PubChem CID 135070776) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 4-(2,3,3,4-tetramethyl-5-morpholin-4-ylpentyl)morpholine.
| Compound Name | 4-(2,3,3,4-tetramethyl-5-morpholin-4-ylpentyl)morpholine |
|---|---|
| PubChem CID | 135070776 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | 4-(2,3,3,4-tetramethyl-5-morpholin-4-ylpentyl)morpholine |
| SMILES | CC(CN1CCOCC1)C(C)(C)C(C)CN1CCOCC1 |
| InChI | InChI=1S/C17H34N2O2/c1-15(13-18-5-9-20-10-6-18)17(3,4)16(2)14-19-7-11-21-12-8-19/h15-16H,5-14H2,1-4H3 |
| InChIKey | DAFIHROFZCUXNI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |