C15H14F7NO2 — CID 135071415
2-(oxan-4-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide (PubChem CID 135071415) has the molecular formula C15H14F7NO2 and a molecular weight of 373.27 g/mol. Its IUPAC name is 2-(oxan-4-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-(oxan-4-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 135071415 |
| Molecular Formula | C15H14F7NO2 |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-(oxan-4-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F)C1CCOCC1 |
| InChI | InChI=1S/C15H14F7NO2/c1-6(7-2-4-25-5-3-7)14(24)23-13-11(18)9(16)8(15(20,21)22)10(17)12(13)19/h6-7H,2-5H2,1H3,(H,23,24) |
| InChIKey | SPRRDJQORKWBLA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|