About N-(3-bromo-2,5,6-trideuterio-4-pyridinyl)-N-methyl-2-phenylpropanamide
N-(3-bromo-2,5,6-trideuterio-4-pyridinyl)-N-methyl-2-phenylpropanamide (PubChem CID 135071720) has the molecular formula C15H15BrN2O
and a molecular weight of 322.22 g/mol. Its IUPAC name is N-(3-bromo-2,5,6-trideuterio-4-pyridinyl)-N-methyl-2-phenylpropanamide.
Molecular Properties
| Compound Name | N-(3-bromo-2,5,6-trideuterio-4-pyridinyl)-N-methyl-2-phenylpropanamide |
| PubChem CID | 135071720 |
| Molecular Formula | C15H15BrN2O |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N-(3-bromo-2,5,6-trideuterio-4-pyridinyl)-N-methyl-2-phenylpropanamide |
| SMILES | [2H]c1nc([2H])c(Br)c(N(C)C(=O)C(C)c2ccccc2)c1[2H] |
| InChI | InChI=1S/C15H15BrN2O/c1-11(12-6-4-3-5-7-12)15(19)18(2)14-8-9-17-10-13(14)16/h3-11H,1-2H3/i8D,9D,10D |
| InChIKey | SZDPMRTUAXTDJA-PSSIPRAESA-N |
| XLogP | 3.61 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-bromo-2,5,6-trideuterio-4-pyridinyl)-N-methyl-2-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-bromo-2,5,6-trideuterio-4-pyridinyl)-N-methyl-2-phenylpropanamide?
The IUPAC name of N-(3-bromo-2,5,6-trideuterio-4-pyridinyl)-N-methyl-2-phenylpropanamide (CID 135071720) is N-(3-bromo-2,5,6-trideuterio-4-pyridinyl)-N-methyl-2-phenylpropanamide.
What is the SMILES notation for N-(3-bromo-2,5,6-trideuterio-4-pyridinyl)-N-methyl-2-phenylpropanamide?
The canonical SMILES for N-(3-bromo-2,5,6-trideuterio-4-pyridinyl)-N-methyl-2-phenylpropanamide is [2H]c1nc([2H])c(Br)c(N(C)C(=O)C(C)c2ccccc2)c1[2H].
What is the InChIKey of N-(3-bromo-2,5,6-trideuterio-4-pyridinyl)-N-methyl-2-phenylpropanamide?
The InChIKey is SZDPMRTUAXTDJA-PSSIPRAESA-N. The full InChI is InChI=1S/C15H15BrN2O/c1-11(12-6-4-3-5-7-12)15(19)18(2)14-8-9-17-10-13(14)16/h3-11H,1-2H3/i8D,9D,10D.
What are the key properties of N-(3-bromo-2,5,6-trideuterio-4-pyridinyl)-N-methyl-2-phenylpropanamide?
N-(3-bromo-2,5,6-trideuterio-4-pyridinyl)-N-methyl-2-phenylpropanamide has a molecular weight of 322.22 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-bromo-2,5,6-trideuterio-4-pyridinyl)-N-methyl-2-phenylpropanamide is sourced from PubChem (CID 135071720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).