About [3-(4-chlorophenyl)-1,7-diphenylhepta-1,6-diyn-3-yl] acetate
[3-(4-chlorophenyl)-1,7-diphenylhepta-1,6-diyn-3-yl] acetate (PubChem CID 135071869) has the molecular formula C27H21ClO2
and a molecular weight of 412.92 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1,7-diphenylhepta-1,6-diyn-3-yl] acetate.
Molecular Properties
| Compound Name | [3-(4-chlorophenyl)-1,7-diphenylhepta-1,6-diyn-3-yl] acetate |
| PubChem CID | 135071869 |
| Molecular Formula | C27H21ClO2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [3-(4-chlorophenyl)-1,7-diphenylhepta-1,6-diyn-3-yl] acetate |
| SMILES | CC(=O)OC(C#Cc1ccccc1)(CCC#Cc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H21ClO2/c1-22(29)30-27(25-15-17-26(28)18-16-25,21-19-24-12-6-3-7-13-24)20-9-8-14-23-10-4-2-5-11-23/h2-7,10-13,15-18H,9,20H2,1H3 |
| InChIKey | SASQPMNJMCPFBP-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-chlorophenyl)-1,7-diphenylhepta-1,6-diyn-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-chlorophenyl)-1,7-diphenylhepta-1,6-diyn-3-yl] acetate?
The IUPAC name of [3-(4-chlorophenyl)-1,7-diphenylhepta-1,6-diyn-3-yl] acetate (CID 135071869) is [3-(4-chlorophenyl)-1,7-diphenylhepta-1,6-diyn-3-yl] acetate.
What is the SMILES notation for [3-(4-chlorophenyl)-1,7-diphenylhepta-1,6-diyn-3-yl] acetate?
The canonical SMILES for [3-(4-chlorophenyl)-1,7-diphenylhepta-1,6-diyn-3-yl] acetate is CC(=O)OC(C#Cc1ccccc1)(CCC#Cc1ccccc1)c1ccc(Cl)cc1.
What is the InChIKey of [3-(4-chlorophenyl)-1,7-diphenylhepta-1,6-diyn-3-yl] acetate?
The InChIKey is SASQPMNJMCPFBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21ClO2/c1-22(29)30-27(25-15-17-26(28)18-16-25,21-19-24-12-6-3-7-13-24)20-9-8-14-23-10-4-2-5-11-23/h2-7,10-13,15-18H,9,20H2,1H3.
What are the key properties of [3-(4-chlorophenyl)-1,7-diphenylhepta-1,6-diyn-3-yl] acetate?
[3-(4-chlorophenyl)-1,7-diphenylhepta-1,6-diyn-3-yl] acetate has a molecular weight of 412.92 g/mol, XLogP of 5.98, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-chlorophenyl)-1,7-diphenylhepta-1,6-diyn-3-yl] acetate is sourced from PubChem (CID 135071869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).