C28H28N2S2 — CID 135071934
4,5-bis[(4-tert-butylphenyl)sulfanyl]benzene-1,2-dicarbonitrile (PubChem CID 135071934) has the molecular formula C28H28N2S2 and a molecular weight of 456.68 g/mol. Its IUPAC name is 4,5-bis[(4-tert-butylphenyl)sulfanyl]benzene-1,2-dicarbonitrile.
| Compound Name | 4,5-bis[(4-tert-butylphenyl)sulfanyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 135071934 |
| Molecular Formula | C28H28N2S2 |
| Molecular Weight | 456.68 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 4,5-bis[(4-tert-butylphenyl)sulfanyl]benzene-1,2-dicarbonitrile |
| SMILES | CC(C)(C)c1ccc(Sc2cc(C#N)c(C#N)cc2Sc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H28N2S2/c1-27(2,3)21-7-11-23(12-8-21)31-25-15-19(17-29)20(18-30)16-26(25)32-24-13-9-22(10-14-24)28(4,5)6/h7-16H,1-6H3 |
| InChIKey | QLDSHOLHCHEOQT-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.68 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |