About [(1S)-1-[(1R,2R)-2-ethenylcyclopent-3-en-1-yl]propyl] dec-9-enoate
[(1S)-1-[(1R,2R)-2-ethenylcyclopent-3-en-1-yl]propyl] dec-9-enoate (PubChem CID 135072026) has the molecular formula C20H32O2
and a molecular weight of 304.47 g/mol. Its IUPAC name is [(1S)-1-[(1R,2R)-2-ethenylcyclopent-3-en-1-yl]propyl] dec-9-enoate.
Molecular Properties
| Compound Name | [(1S)-1-[(1R,2R)-2-ethenylcyclopent-3-en-1-yl]propyl] dec-9-enoate |
| PubChem CID | 135072026 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | [(1S)-1-[(1R,2R)-2-ethenylcyclopent-3-en-1-yl]propyl] dec-9-enoate |
| SMILES | C=CCCCCCCCC(=O)O[C@@H](CC)[C@@H]1CC=C[C@H]1C=C |
| InChI | InChI=1S/C20H32O2/c1-4-7-8-9-10-11-12-16-20(21)22-19(6-3)18-15-13-14-17(18)5-2/h4-5,13-14,17-19H,1-2,6-12,15-16H2,3H3/t17-,18-,19+/m1/s1 |
| InChIKey | SFAYKLKTMSDNOX-QRVBRYPASA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-[(1R,2R)-2-ethenylcyclopent-3-en-1-yl]propyl] dec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-[(1R,2R)-2-ethenylcyclopent-3-en-1-yl]propyl] dec-9-enoate?
The IUPAC name of [(1S)-1-[(1R,2R)-2-ethenylcyclopent-3-en-1-yl]propyl] dec-9-enoate (CID 135072026) is [(1S)-1-[(1R,2R)-2-ethenylcyclopent-3-en-1-yl]propyl] dec-9-enoate.
What is the SMILES notation for [(1S)-1-[(1R,2R)-2-ethenylcyclopent-3-en-1-yl]propyl] dec-9-enoate?
The canonical SMILES for [(1S)-1-[(1R,2R)-2-ethenylcyclopent-3-en-1-yl]propyl] dec-9-enoate is C=CCCCCCCCC(=O)O[C@@H](CC)[C@@H]1CC=C[C@H]1C=C.
What is the InChIKey of [(1S)-1-[(1R,2R)-2-ethenylcyclopent-3-en-1-yl]propyl] dec-9-enoate?
The InChIKey is SFAYKLKTMSDNOX-QRVBRYPASA-N. The full InChI is InChI=1S/C20H32O2/c1-4-7-8-9-10-11-12-16-20(21)22-19(6-3)18-15-13-14-17(18)5-2/h4-5,13-14,17-19H,1-2,6-12,15-16H2,3H3/t17-,18-,19+/m1/s1.
What are the key properties of [(1S)-1-[(1R,2R)-2-ethenylcyclopent-3-en-1-yl]propyl] dec-9-enoate?
[(1S)-1-[(1R,2R)-2-ethenylcyclopent-3-en-1-yl]propyl] dec-9-enoate has a molecular weight of 304.47 g/mol, XLogP of 5.60, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-[(1R,2R)-2-ethenylcyclopent-3-en-1-yl]propyl] dec-9-enoate is sourced from PubChem (CID 135072026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).