C21H19NOS — CID 135072234
2-methylsulfanyl-N,N,2-triphenylacetamide (PubChem CID 135072234) has the molecular formula C21H19NOS and a molecular weight of 333.46 g/mol. Its IUPAC name is 2-methylsulfanyl-N,N,2-triphenylacetamide.
| Compound Name | 2-methylsulfanyl-N,N,2-triphenylacetamide |
|---|---|
| PubChem CID | 135072234 |
| Molecular Formula | C21H19NOS |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-methylsulfanyl-N,N,2-triphenylacetamide |
| SMILES | CSC(C(=O)N(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19NOS/c1-24-20(17-11-5-2-6-12-17)21(23)22(18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16,20H,1H3 |
| InChIKey | RVJLSRIKWHOVDG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |