About 2-methylsulfanyl-N,N,2-triphenylacetamide
2-methylsulfanyl-N,N,2-triphenylacetamide (PubChem CID 135072234) has the molecular formula C21H19NOS
and a molecular weight of 333.46 g/mol. Its IUPAC name is 2-methylsulfanyl-N,N,2-triphenylacetamide.
Molecular Properties
| Compound Name | 2-methylsulfanyl-N,N,2-triphenylacetamide |
| PubChem CID | 135072234 |
| Molecular Formula | C21H19NOS |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-methylsulfanyl-N,N,2-triphenylacetamide |
| SMILES | CSC(C(=O)N(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19NOS/c1-24-20(17-11-5-2-6-12-17)21(23)22(18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16,20H,1H3 |
| InChIKey | RVJLSRIKWHOVDG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylsulfanyl-N,N,2-triphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-N,N,2-triphenylacetamide?
The IUPAC name of 2-methylsulfanyl-N,N,2-triphenylacetamide (CID 135072234) is 2-methylsulfanyl-N,N,2-triphenylacetamide.
What is the SMILES notation for 2-methylsulfanyl-N,N,2-triphenylacetamide?
The canonical SMILES for 2-methylsulfanyl-N,N,2-triphenylacetamide is CSC(C(=O)N(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of 2-methylsulfanyl-N,N,2-triphenylacetamide?
The InChIKey is RVJLSRIKWHOVDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NOS/c1-24-20(17-11-5-2-6-12-17)21(23)22(18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16,20H,1H3.
What are the key properties of 2-methylsulfanyl-N,N,2-triphenylacetamide?
2-methylsulfanyl-N,N,2-triphenylacetamide has a molecular weight of 333.46 g/mol, XLogP of 5.46, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-N,N,2-triphenylacetamide is sourced from PubChem (CID 135072234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).