About (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhexa-4,5-dien-3-ol
(2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhexa-4,5-dien-3-ol (PubChem CID 135072414) has the molecular formula C13H26O3Si
and a molecular weight of 258.43 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhexa-4,5-dien-3-ol.
Molecular Properties
| Compound Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhexa-4,5-dien-3-ol |
| PubChem CID | 135072414 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhexa-4,5-dien-3-ol |
| SMILES | C=C=C(OC)C(O)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O3Si/c1-9-11(15-6)12(14)10(2)16-17(7,8)13(3,4)5/h10,12,14H,1H2,2-8H3/t10-,12?/m0/s1 |
| InChIKey | PHPVPZVZXJTHAT-NUHJPDEHSA-N |
| XLogP | 3.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhexa-4,5-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhexa-4,5-dien-3-ol?
The IUPAC name of (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhexa-4,5-dien-3-ol (CID 135072414) is (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhexa-4,5-dien-3-ol.
What is the SMILES notation for (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhexa-4,5-dien-3-ol?
The canonical SMILES for (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhexa-4,5-dien-3-ol is C=C=C(OC)C(O)[C@H](C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhexa-4,5-dien-3-ol?
The InChIKey is PHPVPZVZXJTHAT-NUHJPDEHSA-N. The full InChI is InChI=1S/C13H26O3Si/c1-9-11(15-6)12(14)10(2)16-17(7,8)13(3,4)5/h10,12,14H,1H2,2-8H3/t10-,12?/m0/s1.
What are the key properties of (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhexa-4,5-dien-3-ol?
(2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhexa-4,5-dien-3-ol has a molecular weight of 258.43 g/mol, XLogP of 3.07, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhexa-4,5-dien-3-ol is sourced from PubChem (CID 135072414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).