About dimethyl 2-[(E)-5-naphthalen-2-ylpent-4-enyl]propanedioate
dimethyl 2-[(E)-5-naphthalen-2-ylpent-4-enyl]propanedioate (PubChem CID 135072454) has the molecular formula C20H22O4
and a molecular weight of 326.39 g/mol. Its IUPAC name is dimethyl 2-[(E)-5-naphthalen-2-ylpent-4-enyl]propanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[(E)-5-naphthalen-2-ylpent-4-enyl]propanedioate |
| PubChem CID | 135072454 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | dimethyl 2-[(E)-5-naphthalen-2-ylpent-4-enyl]propanedioate |
| SMILES | COC(=O)C(CCC/C=C/c1ccc2ccccc2c1)C(=O)OC |
| InChI | InChI=1S/C20H22O4/c1-23-19(21)18(20(22)24-2)11-5-3-4-8-15-12-13-16-9-6-7-10-17(16)14-15/h4,6-10,12-14,18H,3,5,11H2,1-2H3/b8-4+ |
| InChIKey | MYSANWOEVLYBJV-XBXARRHUSA-N |
| XLogP | 3.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[(E)-5-naphthalen-2-ylpent-4-enyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[(E)-5-naphthalen-2-ylpent-4-enyl]propanedioate?
The IUPAC name of dimethyl 2-[(E)-5-naphthalen-2-ylpent-4-enyl]propanedioate (CID 135072454) is dimethyl 2-[(E)-5-naphthalen-2-ylpent-4-enyl]propanedioate.
What is the SMILES notation for dimethyl 2-[(E)-5-naphthalen-2-ylpent-4-enyl]propanedioate?
The canonical SMILES for dimethyl 2-[(E)-5-naphthalen-2-ylpent-4-enyl]propanedioate is COC(=O)C(CCC/C=C/c1ccc2ccccc2c1)C(=O)OC.
What is the InChIKey of dimethyl 2-[(E)-5-naphthalen-2-ylpent-4-enyl]propanedioate?
The InChIKey is MYSANWOEVLYBJV-XBXARRHUSA-N. The full InChI is InChI=1S/C20H22O4/c1-23-19(21)18(20(22)24-2)11-5-3-4-8-15-12-13-16-9-6-7-10-17(16)14-15/h4,6-10,12-14,18H,3,5,11H2,1-2H3/b8-4+.
What are the key properties of dimethyl 2-[(E)-5-naphthalen-2-ylpent-4-enyl]propanedioate?
dimethyl 2-[(E)-5-naphthalen-2-ylpent-4-enyl]propanedioate has a molecular weight of 326.39 g/mol, XLogP of 3.99, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[(E)-5-naphthalen-2-ylpent-4-enyl]propanedioate is sourced from PubChem (CID 135072454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).