About 4-methoxy-4-penta-3,4-dienylcyclohexa-2,5-dien-1-one
4-methoxy-4-penta-3,4-dienylcyclohexa-2,5-dien-1-one (PubChem CID 135072495) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is 4-methoxy-4-penta-3,4-dienylcyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 4-methoxy-4-penta-3,4-dienylcyclohexa-2,5-dien-1-one |
| PubChem CID | 135072495 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 4-methoxy-4-penta-3,4-dienylcyclohexa-2,5-dien-1-one |
| SMILES | C=C=CCCC1(OC)C=CC(=O)C=C1 |
| InChI | InChI=1S/C12H14O2/c1-3-4-5-8-12(14-2)9-6-11(13)7-10-12/h4,6-7,9-10H,1,5,8H2,2H3 |
| InChIKey | OZBYOTBUQSNTID-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-4-penta-3,4-dienylcyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-4-penta-3,4-dienylcyclohexa-2,5-dien-1-one?
The IUPAC name of 4-methoxy-4-penta-3,4-dienylcyclohexa-2,5-dien-1-one (CID 135072495) is 4-methoxy-4-penta-3,4-dienylcyclohexa-2,5-dien-1-one.
What is the SMILES notation for 4-methoxy-4-penta-3,4-dienylcyclohexa-2,5-dien-1-one?
The canonical SMILES for 4-methoxy-4-penta-3,4-dienylcyclohexa-2,5-dien-1-one is C=C=CCCC1(OC)C=CC(=O)C=C1.
What is the InChIKey of 4-methoxy-4-penta-3,4-dienylcyclohexa-2,5-dien-1-one?
The InChIKey is OZBYOTBUQSNTID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c1-3-4-5-8-12(14-2)9-6-11(13)7-10-12/h4,6-7,9-10H,1,5,8H2,2H3.
What are the key properties of 4-methoxy-4-penta-3,4-dienylcyclohexa-2,5-dien-1-one?
4-methoxy-4-penta-3,4-dienylcyclohexa-2,5-dien-1-one has a molecular weight of 190.24 g/mol, XLogP of 2.19, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-4-penta-3,4-dienylcyclohexa-2,5-dien-1-one is sourced from PubChem (CID 135072495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).