C27H33NO7 — CID 135072723
methyl 2-[3-ethynyl-4-(2-methoxyethoxymethoxy)-5-[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]phenyl]acetate (PubChem CID 135072723) has the molecular formula C27H33NO7 and a molecular weight of 483.56 g/mol. Its IUPAC name is methyl 2-[3-ethynyl-4-(2-methoxyethoxymethoxy)-5-[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]phenyl]acetate.
| Compound Name | methyl 2-[3-ethynyl-4-(2-methoxyethoxymethoxy)-5-[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]phenyl]acetate |
|---|---|
| PubChem CID | 135072723 |
| Molecular Formula | C27H33NO7 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | methyl 2-[3-ethynyl-4-(2-methoxyethoxymethoxy)-5-[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]phenyl]acetate |
| SMILES | C#Cc1cc(CC(=O)OC)cc(-c2cccc(CNC(=O)OC(C)(C)C)c2)c1OCOCCOC |
| InChI | InChI=1S/C27H33NO7/c1-7-21-14-20(16-24(29)32-6)15-23(25(21)34-18-33-12-11-31-5)22-10-8-9-19(13-22)17-28-26(30)35-27(2,3)4/h1,8-10,13-15H,11-12,16-18H2,2-6H3,(H,28,30) |
| InChIKey | PJIPEICMQGMJDV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|