About [(E)-4,4-dimethylpent-2-enyl] dipropan-2-yl phosphate
[(E)-4,4-dimethylpent-2-enyl] dipropan-2-yl phosphate (PubChem CID 135073012) has the molecular formula C13H27O4P
and a molecular weight of 278.33 g/mol. Its IUPAC name is [(E)-4,4-dimethylpent-2-enyl] dipropan-2-yl phosphate.
Molecular Properties
| Compound Name | [(E)-4,4-dimethylpent-2-enyl] dipropan-2-yl phosphate |
| PubChem CID | 135073012 |
| Molecular Formula | C13H27O4P |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | [(E)-4,4-dimethylpent-2-enyl] dipropan-2-yl phosphate |
| SMILES | CC(C)OP(=O)(OC/C=C/C(C)(C)C)OC(C)C |
| InChI | InChI=1S/C13H27O4P/c1-11(2)16-18(14,17-12(3)4)15-10-8-9-13(5,6)7/h8-9,11-12H,10H2,1-7H3/b9-8+ |
| InChIKey | YBIBUOFRFMWWJY-CMDGGOBGSA-N |
| XLogP | 4.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4,4-dimethylpent-2-enyl] dipropan-2-yl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4,4-dimethylpent-2-enyl] dipropan-2-yl phosphate?
The IUPAC name of [(E)-4,4-dimethylpent-2-enyl] dipropan-2-yl phosphate (CID 135073012) is [(E)-4,4-dimethylpent-2-enyl] dipropan-2-yl phosphate.
What is the SMILES notation for [(E)-4,4-dimethylpent-2-enyl] dipropan-2-yl phosphate?
The canonical SMILES for [(E)-4,4-dimethylpent-2-enyl] dipropan-2-yl phosphate is CC(C)OP(=O)(OC/C=C/C(C)(C)C)OC(C)C.
What is the InChIKey of [(E)-4,4-dimethylpent-2-enyl] dipropan-2-yl phosphate?
The InChIKey is YBIBUOFRFMWWJY-CMDGGOBGSA-N. The full InChI is InChI=1S/C13H27O4P/c1-11(2)16-18(14,17-12(3)4)15-10-8-9-13(5,6)7/h8-9,11-12H,10H2,1-7H3/b9-8+.
What are the key properties of [(E)-4,4-dimethylpent-2-enyl] dipropan-2-yl phosphate?
[(E)-4,4-dimethylpent-2-enyl] dipropan-2-yl phosphate has a molecular weight of 278.33 g/mol, XLogP of 4.56, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4,4-dimethylpent-2-enyl] dipropan-2-yl phosphate is sourced from PubChem (CID 135073012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).