C43H51NO6SSi — CID 135073156
N-[(2S,3S,4R)-6-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-1,3-bis(phenylmethoxy)hexan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 135073156) has the molecular formula C43H51NO6SSi and a molecular weight of 738.04 g/mol. Its IUPAC name is N-[(2S,3S,4R)-6-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-1,3-bis(phenylmethoxy)hexan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S,3S,4R)-6-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-1,3-bis(phenylmethoxy)hexan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135073156 |
| Molecular Formula | C43H51NO6SSi |
| Molecular Weight | 738.04 g/mol |
| Exact Mass | 737.32 |
| IUPAC Name | N-[(2S,3S,4R)-6-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-1,3-bis(phenylmethoxy)hexan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](O)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C43H51NO6SSi/c1-34-25-27-37(28-26-34)51(46,47)44-40(33-48-31-35-17-9-5-10-18-35)42(49-32-36-19-11-6-12-20-36)41(45)29-30-50-52(43(2,3)4,38-21-13-7-14-22-38)39-23-15-8-16-24-39/h5-28,40-42,44-45H,29-33H2,1-4H3/t40-,41+,42-/m0/s1 |
| InChIKey | OOAQTTNGNJLTOT-ZMWLRIRSSA-N |
| XLogP | 6.77 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.04 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|